C20H32O6 — CID 159920940
2,2-dimethylpropyl ethyl carbonate;2,2-dimethylpropyl phenyl carbonate (PubChem CID 159920940) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 2,2-dimethylpropyl ethyl carbonate;2,2-dimethylpropyl phenyl carbonate.
| Compound Name | 2,2-dimethylpropyl ethyl carbonate;2,2-dimethylpropyl phenyl carbonate |
|---|---|
| PubChem CID | 159920940 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2,2-dimethylpropyl ethyl carbonate;2,2-dimethylpropyl phenyl carbonate |
| SMILES | CC(C)(C)COC(=O)Oc1ccccc1.CCOC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C12H16O3.C8H16O3/c1-12(2,3)9-14-11(13)15-10-7-5-4-6-8-10;1-5-10-7(9)11-6-8(2,3)4/h4-8H,9H2,1-3H3;5-6H2,1-4H3 |
| InChIKey | NYJORHQLUNPZKG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|