C22H30N4O — CID 138666225
3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-1-(3-pyridin-4-ylpyrrolidin-1-yl)but-2-en-1-one (PubChem CID 138666225) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-1-(3-pyridin-4-ylpyrrolidin-1-yl)but-2-en-1-one.
| Compound Name | 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-1-(3-pyridin-4-ylpyrrolidin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 138666225 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-1-(3-pyridin-4-ylpyrrolidin-1-yl)but-2-en-1-one |
| SMILES | C=N/C(NC1(C)CC1)=C(\C)C(C(=O)N1CCC(c2ccncc2)C1)=C(C)C |
| InChI | InChI=1S/C22H30N4O/c1-15(2)19(16(3)20(23-5)25-22(4)9-10-22)21(27)26-13-8-18(14-26)17-6-11-24-12-7-17/h6-7,11-12,18,25H,5,8-10,13-14H2,1-4H3/b20-16- |
| InChIKey | DELIOPIPSDAOSD-SILNSSARSA-N |
| XLogP | 3.81 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|