C23H37F3N4O2 — CID 138671859
tert-butyl N-[4-[2-[1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]carbamate (PubChem CID 138671859) has the molecular formula C23H37F3N4O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 138671859 |
| Molecular Formula | C23H37F3N4O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | tert-butyl N-[4-[2-[1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CCN2CCc3cnn(CCC(F)(F)F)c3CC2)CC1 |
| InChI | InChI=1S/C23H37F3N4O2/c1-22(2,3)32-21(31)28-19-6-4-17(5-7-19)8-12-29-13-9-18-16-27-30(20(18)10-14-29)15-11-23(24,25)26/h16-17,19H,4-15H2,1-3H3,(H,28,31) |
| InChIKey | ABRGBSKWEWREON-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |