C18H28F3N3 — CID 145451861
6-(2-cyclohexylethyl)-1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine (PubChem CID 145451861) has the molecular formula C18H28F3N3 and a molecular weight of 343.44 g/mol. Its IUPAC name is 6-(2-cyclohexylethyl)-1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine.
| Compound Name | 6-(2-cyclohexylethyl)-1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine |
|---|---|
| PubChem CID | 145451861 |
| Molecular Formula | C18H28F3N3 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 6-(2-cyclohexylethyl)-1-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine |
| SMILES | FC(F)(F)CCn1ncc2c1CCN(CCC1CCCCC1)CC2 |
| InChI | InChI=1S/C18H28F3N3/c19-18(20,21)9-13-24-17-8-12-23(11-7-16(17)14-22-24)10-6-15-4-2-1-3-5-15/h14-15H,1-13H2 |
| InChIKey | KDZNXNSLODVKSA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |