C21H22FNO2 — CID 138674464
4-[4-(2-fluorophenyl)phenyl]-N-(3-hydroxy-1-bicyclo[1.1.1]pentanyl)butanamide (PubChem CID 138674464) has the molecular formula C21H22FNO2 and a molecular weight of 339.41 g/mol. Its IUPAC name is 4-[4-(2-fluorophenyl)phenyl]-N-(3-hydroxy-1-bicyclo[1.1.1]pentanyl)butanamide.
| Compound Name | 4-[4-(2-fluorophenyl)phenyl]-N-(3-hydroxy-1-bicyclo[1.1.1]pentanyl)butanamide |
|---|---|
| PubChem CID | 138674464 |
| Molecular Formula | C21H22FNO2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-[4-(2-fluorophenyl)phenyl]-N-(3-hydroxy-1-bicyclo[1.1.1]pentanyl)butanamide |
| SMILES | O=C(CCCc1ccc(-c2ccccc2F)cc1)NC12CC(O)(C1)C2 |
| InChI | InChI=1S/C21H22FNO2/c22-18-6-2-1-5-17(18)16-10-8-15(9-11-16)4-3-7-19(24)23-20-12-21(25,13-20)14-20/h1-2,5-6,8-11,25H,3-4,7,12-14H2,(H,23,24) |
| InChIKey | MOETYDFLMQQXMO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |