C21H23FO — CID 157389572
1-cyclopropyl-6-[4-(2-fluorophenyl)phenyl]hexan-3-one (PubChem CID 157389572) has the molecular formula C21H23FO and a molecular weight of 310.41 g/mol. Its IUPAC name is 1-cyclopropyl-6-[4-(2-fluorophenyl)phenyl]hexan-3-one.
| Compound Name | 1-cyclopropyl-6-[4-(2-fluorophenyl)phenyl]hexan-3-one |
|---|---|
| PubChem CID | 157389572 |
| Molecular Formula | C21H23FO |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-cyclopropyl-6-[4-(2-fluorophenyl)phenyl]hexan-3-one |
| SMILES | O=C(CCCc1ccc(-c2ccccc2F)cc1)CCC1CC1 |
| InChI | InChI=1S/C21H23FO/c22-21-7-2-1-6-20(21)18-13-10-16(11-14-18)4-3-5-19(23)15-12-17-8-9-17/h1-2,6-7,10-11,13-14,17H,3-5,8-9,12,15H2 |
| InChIKey | BLVLIYFYUBIDKT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |