C29H32FNO4 — CID 138677398
5-[(2S,4S)-2-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]-2-methylbenzoic acid (PubChem CID 138677398) has the molecular formula C29H32FNO4 and a molecular weight of 477.58 g/mol. Its IUPAC name is 5-[(2S,4S)-2-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]-2-methylbenzoic acid.
| Compound Name | 5-[(2S,4S)-2-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 138677398 |
| Molecular Formula | C29H32FNO4 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 5-[(2S,4S)-2-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]-2-methylbenzoic acid |
| SMILES | COc1cc(C(C)NCCC[C@H]2C[C@@H](c3ccc(C)c(C(=O)O)c3)c3ccccc3O2)ccc1F |
| InChI | InChI=1S/C29H32FNO4/c1-18-10-11-21(15-24(18)29(32)33)25-17-22(35-27-9-5-4-8-23(25)27)7-6-14-31-19(2)20-12-13-26(30)28(16-20)34-3/h4-5,8-13,15-16,19,22,25,31H,6-7,14,17H2,1-3H3,(H,32,33)/t19?,22-,25-/m0/s1 |
| InChIKey | AULYXQRHAIPOCD-ZJSQPSORSA-N |
| XLogP | 6.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|