C32H32FNO3 — CID 71730864
methyl 2-fluoro-5-[(2S,4S)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoate (PubChem CID 71730864) has the molecular formula C32H32FNO3 and a molecular weight of 497.61 g/mol. Its IUPAC name is methyl 2-fluoro-5-[(2S,4S)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoate.
| Compound Name | methyl 2-fluoro-5-[(2S,4S)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoate |
|---|---|
| PubChem CID | 71730864 |
| Molecular Formula | C32H32FNO3 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | methyl 2-fluoro-5-[(2S,4S)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoate |
| SMILES | COC(=O)c1cc([C@@H]2C[C@H](CCCN[C@H](C)c3cccc4ccccc34)Oc3ccccc32)ccc1F |
| InChI | InChI=1S/C32H32FNO3/c1-21(25-14-7-10-22-9-3-4-12-26(22)25)34-18-8-11-24-20-28(27-13-5-6-15-31(27)37-24)23-16-17-30(33)29(19-23)32(35)36-2/h3-7,9-10,12-17,19,21,24,28,34H,8,11,18,20H2,1-2H3/t21-,24+,28+/m1/s1 |
| InChIKey | YLUMNHLRHLHGTK-NZRVCZAQSA-N |
| XLogP | 7.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|