C31H30FNO3 — CID 123632078
4-[2-[3-[1-(4-fluoronaphthalen-1-yl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid (PubChem CID 123632078) has the molecular formula C31H30FNO3 and a molecular weight of 483.58 g/mol. Its IUPAC name is 4-[2-[3-[1-(4-fluoronaphthalen-1-yl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid.
| Compound Name | 4-[2-[3-[1-(4-fluoronaphthalen-1-yl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid |
|---|---|
| PubChem CID | 123632078 |
| Molecular Formula | C31H30FNO3 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 4-[2-[3-[1-(4-fluoronaphthalen-1-yl)ethylamino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid |
| SMILES | CC(NCCCC1CC(c2ccc(C(=O)O)cc2)c2ccccc2O1)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C31H30FNO3/c1-20(24-16-17-29(32)26-9-3-2-8-25(24)26)33-18-6-7-23-19-28(27-10-4-5-11-30(27)36-23)21-12-14-22(15-13-21)31(34)35/h2-5,8-17,20,23,28,33H,6-7,18-19H2,1H3,(H,34,35) |
| InChIKey | YTXORNHGIVIWCJ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|