C33H36ClNO3 — CID 138677309
2,6-dimethyl-3-[(2S,4S)-2-[3-(1-naphthalen-1-ylethylamino)propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid;hydrochloride (PubChem CID 138677309) has the molecular formula C33H36ClNO3 and a molecular weight of 530.11 g/mol. Its IUPAC name is 2,6-dimethyl-3-[(2S,4S)-2-[3-(1-naphthalen-1-ylethylamino)propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid;hydrochloride.
| Compound Name | 2,6-dimethyl-3-[(2S,4S)-2-[3-(1-naphthalen-1-ylethylamino)propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 138677309 |
| Molecular Formula | C33H36ClNO3 |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 2,6-dimethyl-3-[(2S,4S)-2-[3-(1-naphthalen-1-ylethylamino)propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid;hydrochloride |
| SMILES | Cc1ccc([C@@H]2C[C@H](CCCNC(C)c3cccc4ccccc34)Oc3ccccc32)c(C)c1C(=O)O.Cl |
| InChI | InChI=1S/C33H35NO3.ClH/c1-21-17-18-26(22(2)32(21)33(35)36)30-20-25(37-31-16-7-6-14-29(30)31)12-9-19-34-23(3)27-15-8-11-24-10-4-5-13-28(24)27;/h4-8,10-11,13-18,23,25,30,34H,9,12,19-20H2,1-3H3,(H,35,36);1H/t23?,25-,30-;/m0./s1 |
| InChIKey | IFNPOWHFMMLYTP-FYOVNVKHSA-N |
| XLogP | 7.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|