C32H32FNO3 — CID 126683845
2-fluoro-3-methyl-5-[(2R,4R)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid (PubChem CID 126683845) has the molecular formula C32H32FNO3 and a molecular weight of 497.61 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-[(2R,4R)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid.
| Compound Name | 2-fluoro-3-methyl-5-[(2R,4R)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid |
|---|---|
| PubChem CID | 126683845 |
| Molecular Formula | C32H32FNO3 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 2-fluoro-3-methyl-5-[(2R,4R)-2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]-3,4-dihydro-2H-chromen-4-yl]benzoic acid |
| SMILES | Cc1cc([C@H]2C[C@@H](CCCN[C@H](C)c3cccc4ccccc34)Oc3ccccc32)cc(C(=O)O)c1F |
| InChI | InChI=1S/C32H32FNO3/c1-20-17-23(18-29(31(20)33)32(35)36)28-19-24(37-30-15-6-5-13-27(28)30)11-8-16-34-21(2)25-14-7-10-22-9-3-4-12-26(22)25/h3-7,9-10,12-15,17-18,21,24,28,34H,8,11,16,19H2,1-2H3,(H,35,36)/t21-,24-,28-/m1/s1 |
| InChIKey | PZDQJILTBCIMDB-ATEJDMMGSA-N |
| XLogP | 7.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|