C10H16Cl2N2O2S — CID 138677601
N-[2-(aminomethyl)-4-chlorophenyl]-N-ethylmethanesulfonamide;hydrochloride (PubChem CID 138677601) has the molecular formula C10H16Cl2N2O2S and a molecular weight of 299.22 g/mol. Its IUPAC name is N-[2-(aminomethyl)-4-chlorophenyl]-N-ethylmethanesulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)-4-chlorophenyl]-N-ethylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 138677601 |
| Molecular Formula | C10H16Cl2N2O2S |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-[2-(aminomethyl)-4-chlorophenyl]-N-ethylmethanesulfonamide;hydrochloride |
| SMILES | CCN(c1ccc(Cl)cc1CN)S(C)(=O)=O.Cl |
| InChI | InChI=1S/C10H15ClN2O2S.ClH/c1-3-13(16(2,14)15)10-5-4-9(11)6-8(10)7-12;/h4-6H,3,7,12H2,1-2H3;1H |
| InChIKey | WYGDYNUGNWVWKU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |