C21H20N6O2S — CID 138682584
N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 138682584) has the molecular formula C21H20N6O2S and a molecular weight of 420.50 g/mol. Its IUPAC name is N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138682584 |
| Molecular Formula | C21H20N6O2S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)c3cc(-c4cnco4)sc3n2)c1 |
| InChI | InChI=1S/C21H20N6O2S/c1-14-3-2-4-15(9-14)11-23-26-21-24-19(27-5-7-28-8-6-27)16-10-18(30-20(16)25-21)17-12-22-13-29-17/h2-4,9-13H,5-8H2,1H3,(H,24,25,26)/b23-11+ |
| InChIKey | KCENLUKZZQIBFH-FOKLQQMPSA-N |
| XLogP | 3.94 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|