C20H27N7O3S — CID 164784119
N,N-dimethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-sulfonamide (PubChem CID 164784119) has the molecular formula C20H27N7O3S and a molecular weight of 445.55 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-sulfonamide.
| Compound Name | N,N-dimethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 164784119 |
| Molecular Formula | C20H27N7O3S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N,N-dimethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-sulfonamide |
| SMILES | Cc1cccc(/C=N/Nc2nc3c(c(N4CCOCC4)n2)CN(S(=O)(=O)N(C)C)C3)c1 |
| InChI | InChI=1S/C20H27N7O3S/c1-15-5-4-6-16(11-15)12-21-24-20-22-18-14-27(31(28,29)25(2)3)13-17(18)19(23-20)26-7-9-30-10-8-26/h4-6,11-12H,7-10,13-14H2,1-3H3,(H,22,23,24)/b21-12+ |
| InChIKey | HMSTWAGUHSXHCQ-CIAFOILYSA-N |
| XLogP | 1.19 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|