C27H31N5O2 — CID 155350658
4-cyclopropyl-1-[2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl]but-3-yn-2-one (PubChem CID 155350658) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 4-cyclopropyl-1-[2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl]but-3-yn-2-one.
| Compound Name | 4-cyclopropyl-1-[2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl]but-3-yn-2-one |
|---|---|
| PubChem CID | 155350658 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-cyclopropyl-1-[2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl]but-3-yn-2-one |
| SMILES | Cc1cccc(/C=N/Nc2nc3c(c(N4CCOCC4)n2)CC(CC(=O)C#CC2CC2)CC3)c1 |
| InChI | InChI=1S/C27H31N5O2/c1-19-3-2-4-22(15-19)18-28-31-27-29-25-10-8-21(16-23(33)9-7-20-5-6-20)17-24(25)26(30-27)32-11-13-34-14-12-32/h2-4,15,18,20-21H,5-6,8,10-14,16-17H2,1H3,(H,29,30,31)/b28-18+ |
| InChIKey | QEOCGPGLBSQSBX-MTDXEUNCSA-N |
| XLogP | 3.55 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|