C25H31N7O2 — CID 172966903
2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-N-piperidin-4-yl-5H-cyclopenta[d]pyrimidine-6-carboxamide (PubChem CID 172966903) has the molecular formula C25H31N7O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-N-piperidin-4-yl-5H-cyclopenta[d]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-N-piperidin-4-yl-5H-cyclopenta[d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 172966903 |
| Molecular Formula | C25H31N7O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-N-piperidin-4-yl-5H-cyclopenta[d]pyrimidine-6-carboxamide |
| SMILES | Cc1cccc(/C=N/Nc2nc3c(c(N4CCOCC4)n2)CC(C(=O)NC2CCNCC2)=C3)c1 |
| InChI | InChI=1S/C25H31N7O2/c1-17-3-2-4-18(13-17)16-27-31-25-29-22-15-19(24(33)28-20-5-7-26-8-6-20)14-21(22)23(30-25)32-9-11-34-12-10-32/h2-4,13,15-16,20,26H,5-12,14H2,1H3,(H,28,33)(H,29,30,31)/b27-16+ |
| InChIKey | CDGLZPZUGSICEP-JVWAILMASA-N |
| XLogP | 1.88 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|