C24H30N8O2 — CID 138682292
N-cyclohexyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-7H-purine-8-carboxamide (PubChem CID 138682292) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-7H-purine-8-carboxamide.
| Compound Name | N-cyclohexyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-7H-purine-8-carboxamide |
|---|---|
| PubChem CID | 138682292 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-cyclohexyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-7H-purine-8-carboxamide |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)c3[nH]c(C(=O)NC4CCCCC4)nc3n2)c1 |
| InChI | InChI=1S/C24H30N8O2/c1-16-6-5-7-17(14-16)15-25-31-24-29-20-19(22(30-24)32-10-12-34-13-11-32)27-21(28-20)23(33)26-18-8-3-2-4-9-18/h5-7,14-15,18H,2-4,8-13H2,1H3,(H,26,33)(H2,27,28,29,30,31)/b25-15+ |
| InChIKey | YANVTEJYFOHNEY-MFKUBSTISA-N |
| XLogP | 3.01 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|