C23H22N8O3 — CID 138682574
5-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-7-morpholin-4-yl-N-pyridin-2-yl-[1,3]oxazolo[4,5-d]pyrimidine-2-carboxamide (PubChem CID 138682574) has the molecular formula C23H22N8O3 and a molecular weight of 458.48 g/mol. Its IUPAC name is 5-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-7-morpholin-4-yl-N-pyridin-2-yl-[1,3]oxazolo[4,5-d]pyrimidine-2-carboxamide.
| Compound Name | 5-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-7-morpholin-4-yl-N-pyridin-2-yl-[1,3]oxazolo[4,5-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 138682574 |
| Molecular Formula | C23H22N8O3 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-7-morpholin-4-yl-N-pyridin-2-yl-[1,3]oxazolo[4,5-d]pyrimidine-2-carboxamide |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)c3oc(C(=O)Nc4ccccn4)nc3n2)c1 |
| InChI | InChI=1S/C23H22N8O3/c1-15-5-4-6-16(13-15)14-25-30-23-28-19-18(20(29-23)31-9-11-33-12-10-31)34-22(27-19)21(32)26-17-7-2-3-8-24-17/h2-8,13-14H,9-12H2,1H3,(H,24,26,32)(H,28,29,30)/b25-14+ |
| InChIKey | QJQSYRSPGKDAJY-AFUMVMLFSA-N |
| XLogP | 2.86 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|