C8H16F3NO — CID 138687370
N,N-diethyl-1-(1,2,2-trifluoroethoxy)ethanamine (PubChem CID 138687370) has the molecular formula C8H16F3NO and a molecular weight of 199.22 g/mol. Its IUPAC name is N,N-diethyl-1-(1,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N,N-diethyl-1-(1,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 138687370 |
| Molecular Formula | C8H16F3NO |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N,N-diethyl-1-(1,2,2-trifluoroethoxy)ethanamine |
| SMILES | CCN(CC)C(C)OC(F)C(F)F |
| InChI | InChI=1S/C8H16F3NO/c1-4-12(5-2)6(3)13-8(11)7(9)10/h6-8H,4-5H2,1-3H3 |
| InChIKey | NORNRLXBFGYLLT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|