C10H18F6NO+ — CID 57074527
triethyl(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)azanium (PubChem CID 57074527) has the molecular formula C10H18F6NO+ and a molecular weight of 282.25 g/mol. Its IUPAC name is triethyl(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)azanium.
| Compound Name | triethyl(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)azanium |
|---|---|
| PubChem CID | 57074527 |
| Molecular Formula | C10H18F6NO+ |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | triethyl(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)azanium |
| SMILES | CC[N+](CC)(CC)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H18F6NO/c1-4-17(5-2,6-3)7-18-8(9(11,12)13)10(14,15)16/h8H,4-7H2,1-3H3/q+1 |
| InChIKey | YDFLASMQCYMQRD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|