C14H17LiN2O4 — CID 138689723
lithium 6-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyridine-3-carboxylate (PubChem CID 138689723) has the molecular formula C14H17LiN2O4 and a molecular weight of 284.24 g/mol. Its IUPAC name is lithium 6-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyridine-3-carboxylate.
| Compound Name | lithium 6-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 138689723 |
| Molecular Formula | C14H17LiN2O4 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | lithium 6-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(C(=O)[O-])cn2)C1.[Li+] |
| InChI | InChI=1S/C14H18N2O4.Li/c1-14(2,3)20-13(19)16-7-10(8-16)11-5-4-9(6-15-11)12(17)18;/h4-6,10H,7-8H2,1-3H3,(H,17,18);/q;+1/p-1 |
| InChIKey | TZVFWNINJFKYTG-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |