C11H10N6 — CID 138692755
N-(pyrazin-2-ylmethyl)-1H-pyrazolo[4,3-b]pyridin-7-amine (PubChem CID 138692755) has the molecular formula C11H10N6 and a molecular weight of 226.24 g/mol. Its IUPAC name is N-(pyrazin-2-ylmethyl)-1H-pyrazolo[4,3-b]pyridin-7-amine.
| Compound Name | N-(pyrazin-2-ylmethyl)-1H-pyrazolo[4,3-b]pyridin-7-amine |
|---|---|
| PubChem CID | 138692755 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N-(pyrazin-2-ylmethyl)-1H-pyrazolo[4,3-b]pyridin-7-amine |
| SMILES | c1cnc(CNc2ccnc3cn[nH]c23)cn1 |
| InChI | InChI=1S/C11H10N6/c1-2-14-10-7-16-17-11(10)9(1)15-6-8-5-12-3-4-13-8/h1-5,7H,6H2,(H,14,15)(H,16,17) |
| InChIKey | KGKHUMYJAHKJNW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |