C18H23FN2O3S — CID 138696861
5-fluoro-7-(2-methylpropoxy)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 138696861) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-fluoro-7-(2-methylpropoxy)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 5-fluoro-7-(2-methylpropoxy)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138696861 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 5-fluoro-7-(2-methylpropoxy)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | CC(C)COc1cc(F)c2c(=O)[nH]c(CSC3CCOCC3)nc2c1 |
| InChI | InChI=1S/C18H23FN2O3S/c1-11(2)9-24-12-7-14(19)17-15(8-12)20-16(21-18(17)22)10-25-13-3-5-23-6-4-13/h7-8,11,13H,3-6,9-10H2,1-2H3,(H,20,21,22) |
| InChIKey | TWFUYKKIMNGDAO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |