C16H18BrFN2O3S — CID 170749413
7-(2-bromoethoxy)-5-fluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 170749413) has the molecular formula C16H18BrFN2O3S and a molecular weight of 417.30 g/mol. Its IUPAC name is 7-(2-bromoethoxy)-5-fluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 7-(2-bromoethoxy)-5-fluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 170749413 |
| Molecular Formula | C16H18BrFN2O3S |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 7-(2-bromoethoxy)-5-fluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSC2CCOCC2)nc2cc(OCCBr)cc(F)c12 |
| InChI | InChI=1S/C16H18BrFN2O3S/c17-3-6-23-10-7-12(18)15-13(8-10)19-14(20-16(15)21)9-24-11-1-4-22-5-2-11/h7-8,11H,1-6,9H2,(H,19,20,21) |
| InChIKey | OHHWTNKCMPSJQO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|