C30H36FN5O5S — CID 170749619
5-fluoro-7-[2-[1-[1-(4-nitrophenyl)azetidin-3-yl]piperidin-4-yl]ethoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 170749619) has the molecular formula C30H36FN5O5S and a molecular weight of 597.71 g/mol. Its IUPAC name is 5-fluoro-7-[2-[1-[1-(4-nitrophenyl)azetidin-3-yl]piperidin-4-yl]ethoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 5-fluoro-7-[2-[1-[1-(4-nitrophenyl)azetidin-3-yl]piperidin-4-yl]ethoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 170749619 |
| Molecular Formula | C30H36FN5O5S |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 5-fluoro-7-[2-[1-[1-(4-nitrophenyl)azetidin-3-yl]piperidin-4-yl]ethoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSC2CCOCC2)nc2cc(OCCC3CCN(C4CN(c5ccc([N+](=O)[O-])cc5)C4)CC3)cc(F)c12 |
| InChI | InChI=1S/C30H36FN5O5S/c31-26-15-24(16-27-29(26)30(37)33-28(32-27)19-42-25-8-12-40-13-9-25)41-14-7-20-5-10-34(11-6-20)23-17-35(18-23)21-1-3-22(4-2-21)36(38)39/h1-4,15-16,20,23,25H,5-14,17-19H2,(H,32,33,37) |
| InChIKey | IAOUIMYRHGFHGB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|