C33H39F2N5O7S — CID 170749327
5-fluoro-7-[[1-[2-[1-(3-fluoro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetyl]piperidin-4-yl]methoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 170749327) has the molecular formula C33H39F2N5O7S and a molecular weight of 687.77 g/mol. Its IUPAC name is 5-fluoro-7-[[1-[2-[1-(3-fluoro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetyl]piperidin-4-yl]methoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 5-fluoro-7-[[1-[2-[1-(3-fluoro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetyl]piperidin-4-yl]methoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 170749327 |
| Molecular Formula | C33H39F2N5O7S |
| Molecular Weight | 687.77 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | 5-fluoro-7-[[1-[2-[1-(3-fluoro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetyl]piperidin-4-yl]methoxy]-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | O=C(CC1(O)CCN(c2ccc([N+](=O)[O-])c(F)c2)CC1)N1CCC(COc2cc(F)c3c(=O)[nH]c(CSC4CCOCC4)nc3c2)CC1 |
| InChI | InChI=1S/C33H39F2N5O7S/c34-25-15-22(1-2-28(25)40(44)45)38-11-7-33(43,8-12-38)18-30(41)39-9-3-21(4-10-39)19-47-23-16-26(35)31-27(17-23)36-29(37-32(31)42)20-48-24-5-13-46-14-6-24/h1-2,15-17,21,24,43H,3-14,18-20H2,(H,36,37,42) |
| InChIKey | YHTVYVGVBSSRRI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|