C32H37F2N5O7S — CID 174219803
(2-fluoro-4-nitrophenyl)-[3-[[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]methyl]cyclobutyl]carbamic acid (PubChem CID 174219803) has the molecular formula C32H37F2N5O7S and a molecular weight of 673.74 g/mol. Its IUPAC name is (2-fluoro-4-nitrophenyl)-[3-[[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]methyl]cyclobutyl]carbamic acid.
| Compound Name | (2-fluoro-4-nitrophenyl)-[3-[[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]methyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 174219803 |
| Molecular Formula | C32H37F2N5O7S |
| Molecular Weight | 673.74 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | (2-fluoro-4-nitrophenyl)-[3-[[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]methyl]cyclobutyl]carbamic acid |
| SMILES | O=C(O)N(c1ccc([N+](=O)[O-])cc1F)C1CC(CN2CCC(COc3cc(F)c4c(=O)[nH]c(CSC5CCOCC5)nc4c3)CC2)C1 |
| InChI | InChI=1S/C32H37F2N5O7S/c33-25-13-21(39(43)44)1-2-28(25)38(32(41)42)22-11-20(12-22)16-37-7-3-19(4-8-37)17-46-23-14-26(34)30-27(15-23)35-29(36-31(30)40)18-47-24-5-9-45-10-6-24/h1-2,13-15,19-20,22,24H,3-12,16-18H2,(H,41,42)(H,35,36,40) |
| InChIKey | ZJNZLRSKBSNGPH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|