C16H17FN2O3S — CID 170748896
2-[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]acetaldehyde (PubChem CID 170748896) has the molecular formula C16H17FN2O3S and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]acetaldehyde.
| Compound Name | 2-[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 170748896 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]acetaldehyde |
| SMILES | O=CCc1cc(F)c2c(=O)[nH]c(CSC3CCOCC3)nc2c1 |
| InChI | InChI=1S/C16H17FN2O3S/c17-12-7-10(1-4-20)8-13-15(12)16(21)19-14(18-13)9-23-11-2-5-22-6-3-11/h4,7-8,11H,1-3,5-6,9H2,(H,18,19,21) |
| InChIKey | ZJHBAMKJLNXATD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|