C15H17FN2O3S — CID 138697166
5-fluoro-7-hydroxy-2-[(4-hydroxycyclohexyl)sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 138697166) has the molecular formula C15H17FN2O3S and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-fluoro-7-hydroxy-2-[(4-hydroxycyclohexyl)sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 5-fluoro-7-hydroxy-2-[(4-hydroxycyclohexyl)sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138697166 |
| Molecular Formula | C15H17FN2O3S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-fluoro-7-hydroxy-2-[(4-hydroxycyclohexyl)sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSC2CCC(O)CC2)nc2cc(O)cc(F)c12 |
| InChI | InChI=1S/C15H17FN2O3S/c16-11-5-9(20)6-12-14(11)15(21)18-13(17-12)7-22-10-3-1-8(19)2-4-10/h5-6,8,10,19-20H,1-4,7H2,(H,17,18,21) |
| InChIKey | YCMODJBNMAZJOP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |