C20H27FN4O2S — CID 138696339
5-fluoro-7-(oxan-4-ylmethylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 138696339) has the molecular formula C20H27FN4O2S and a molecular weight of 406.53 g/mol. Its IUPAC name is 5-fluoro-7-(oxan-4-ylmethylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 5-fluoro-7-(oxan-4-ylmethylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138696339 |
| Molecular Formula | C20H27FN4O2S |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-fluoro-7-(oxan-4-ylmethylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSC2CCNCC2)nc2cc(NCC3CCOCC3)cc(F)c12 |
| InChI | InChI=1S/C20H27FN4O2S/c21-16-9-14(23-11-13-3-7-27-8-4-13)10-17-19(16)20(26)25-18(24-17)12-28-15-1-5-22-6-2-15/h9-10,13,15,22-23H,1-8,11-12H2,(H,24,25,26) |
| InChIKey | BATZSNOQNABPGB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |