C21H25ClFN3O2S — CID 170749371
5-fluoro-2-(oxan-4-ylsulfanylmethyl)-7-(2-piperidin-4-ylethynyl)-3H-quinazolin-4-one;hydrochloride (PubChem CID 170749371) has the molecular formula C21H25ClFN3O2S and a molecular weight of 437.97 g/mol. Its IUPAC name is 5-fluoro-2-(oxan-4-ylsulfanylmethyl)-7-(2-piperidin-4-ylethynyl)-3H-quinazolin-4-one;hydrochloride.
| Compound Name | 5-fluoro-2-(oxan-4-ylsulfanylmethyl)-7-(2-piperidin-4-ylethynyl)-3H-quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 170749371 |
| Molecular Formula | C21H25ClFN3O2S |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 5-fluoro-2-(oxan-4-ylsulfanylmethyl)-7-(2-piperidin-4-ylethynyl)-3H-quinazolin-4-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c(CSC2CCOCC2)nc2cc(C#CC3CCNCC3)cc(F)c12 |
| InChI | InChI=1S/C21H24FN3O2S.ClH/c22-17-11-15(2-1-14-3-7-23-8-4-14)12-18-20(17)21(26)25-19(24-18)13-28-16-5-9-27-10-6-16;/h11-12,14,16,23H,3-10,13H2,(H,24,25,26);1H |
| InChIKey | JGROOCMREVXDPS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|