C15H17FN2O3S — CID 138696992
7-fluoro-5-(hydroxymethyl)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 138696992) has the molecular formula C15H17FN2O3S and a molecular weight of 324.38 g/mol. Its IUPAC name is 7-fluoro-5-(hydroxymethyl)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 7-fluoro-5-(hydroxymethyl)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138696992 |
| Molecular Formula | C15H17FN2O3S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 7-fluoro-5-(hydroxymethyl)-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSC2CCOCC2)nc2cc(F)cc(CO)c12 |
| InChI | InChI=1S/C15H17FN2O3S/c16-10-5-9(7-19)14-12(6-10)17-13(18-15(14)20)8-22-11-1-3-21-4-2-11/h5-6,11,19H,1-4,7-8H2,(H,17,18,20) |
| InChIKey | QDZREOIKPREWBH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |