C21H31N3O2S — CID 158657048
7-(cyclopentylamino)-5-methyl-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one;methane (PubChem CID 158657048) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is 7-(cyclopentylamino)-5-methyl-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one;methane.
| Compound Name | 7-(cyclopentylamino)-5-methyl-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one;methane |
|---|---|
| PubChem CID | 158657048 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 7-(cyclopentylamino)-5-methyl-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one;methane |
| SMILES | C.Cc1cc(NC2CCCC2)cc2nc(CSC3CCOCC3)[nH]c(=O)c12 |
| InChI | InChI=1S/C20H27N3O2S.CH4/c1-13-10-15(21-14-4-2-3-5-14)11-17-19(13)20(24)23-18(22-17)12-26-16-6-8-25-9-7-16;/h10-11,14,16,21H,2-9,12H2,1H3,(H,22,23,24);1H4 |
| InChIKey | ICGQIZFQXSIYRD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |