C19H27ClN4OS — CID 138697136
7-(cyclopentylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one;hydrochloride (PubChem CID 138697136) has the molecular formula C19H27ClN4OS and a molecular weight of 394.97 g/mol. Its IUPAC name is 7-(cyclopentylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one;hydrochloride.
| Compound Name | 7-(cyclopentylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 138697136 |
| Molecular Formula | C19H27ClN4OS |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 7-(cyclopentylamino)-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c(CSC2CCNCC2)nc2cc(NC3CCCC3)ccc12 |
| InChI | InChI=1S/C19H26N4OS.ClH/c24-19-16-6-5-14(21-13-3-1-2-4-13)11-17(16)22-18(23-19)12-25-15-7-9-20-10-8-15;/h5-6,11,13,15,20-21H,1-4,7-10,12H2,(H,22,23,24);1H |
| InChIKey | AYBXSUAJWABCEU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |