C27H38FNO3 — CID 138699761
5-cyclopropyl-4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methoxy]-2-fluoro-N-methyl-N-(4-oxobutyl)benzamide (PubChem CID 138699761) has the molecular formula C27H38FNO3 and a molecular weight of 443.60 g/mol. Its IUPAC name is 5-cyclopropyl-4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methoxy]-2-fluoro-N-methyl-N-(4-oxobutyl)benzamide.
| Compound Name | 5-cyclopropyl-4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methoxy]-2-fluoro-N-methyl-N-(4-oxobutyl)benzamide |
|---|---|
| PubChem CID | 138699761 |
| Molecular Formula | C27H38FNO3 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 5-cyclopropyl-4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methoxy]-2-fluoro-N-methyl-N-(4-oxobutyl)benzamide |
| SMILES | CC1CC2CC(C1)CC(C)(COc1cc(F)c(C(=O)N(C)CCCC=O)cc1C1CC1)C2 |
| InChI | InChI=1S/C27H38FNO3/c1-18-10-19-12-20(11-18)16-27(2,15-19)17-32-25-14-24(28)23(13-22(25)21-6-7-21)26(31)29(3)8-4-5-9-30/h9,13-14,18-21H,4-8,10-12,15-17H2,1-3H3 |
| InChIKey | GVLYILKNVIJPNY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|