C19H19FN6OS2 — CID 138701449
2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-[5-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-2-methylpropanamide (PubChem CID 138701449) has the molecular formula C19H19FN6OS2 and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-[5-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-2-methylpropanamide.
| Compound Name | 2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-[5-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 138701449 |
| Molecular Formula | C19H19FN6OS2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-[5-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ncc(-c2cncc(F)c2)cn1)c1csc(NSC2CC2)n1 |
| InChI | InChI=1S/C19H19FN6OS2/c1-19(2,15-10-28-18(24-15)26-29-14-3-4-14)16(27)25-17-22-7-12(8-23-17)11-5-13(20)9-21-6-11/h5-10,14H,3-4H2,1-2H3,(H,24,26)(H,22,23,25,27) |
| InChIKey | DILGNLDYHLTARJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|