C9H17NO2 — CID 138701459
(1R,5R)-5-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-amine (PubChem CID 138701459) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (1R,5R)-5-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-amine.
| Compound Name | (1R,5R)-5-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 138701459 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (1R,5R)-5-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-amine |
| SMILES | COC(C)(C)O[C@@H]1CC=C[C@H]1N |
| InChI | InChI=1S/C9H17NO2/c1-9(2,11-3)12-8-6-4-5-7(8)10/h4-5,7-8H,6,10H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | NJXVEFNUTHCGMX-HTQZYQBOSA-N |
| XLogP | 1.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|