C21H17N5O2 — CID 1387022
(E)-3-(4-methoxyphenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide (PubChem CID 1387022) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1387022 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nc3nccc(-c4ccccc4)n3n2)cc1 |
| InChI | InChI=1S/C21H17N5O2/c1-28-17-10-7-15(8-11-17)9-12-19(27)23-20-24-21-22-14-13-18(26(21)25-20)16-5-3-2-4-6-16/h2-14H,1H3,(H,23,25,27)/b12-9+ |
| InChIKey | SJQMJBNRBIACMY-FMIVXFBMSA-N |
| XLogP | 3.45 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|