C8H7F3NO2P — CID 138702850
6-(2,2-difluoro-2-phosphanylethoxy)-5-fluoropyridine-3-carbaldehyde (PubChem CID 138702850) has the molecular formula C8H7F3NO2P and a molecular weight of 237.12 g/mol. Its IUPAC name is 6-(2,2-difluoro-2-phosphanylethoxy)-5-fluoropyridine-3-carbaldehyde.
| Compound Name | 6-(2,2-difluoro-2-phosphanylethoxy)-5-fluoropyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 138702850 |
| Molecular Formula | C8H7F3NO2P |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 6-(2,2-difluoro-2-phosphanylethoxy)-5-fluoropyridine-3-carbaldehyde |
| SMILES | O=Cc1cnc(OCC(F)(F)P)c(F)c1 |
| InChI | InChI=1S/C8H7F3NO2P/c9-6-1-5(3-13)2-12-7(6)14-4-8(10,11)15/h1-3H,4,15H2 |
| InChIKey | OWRBJUOEDDMIOK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|