C13H12F3N3O4S — CID 138703356
[2-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)carbamoyl]-6-(trifluoromethyl)phenyl]methanesulfinic acid (PubChem CID 138703356) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is [2-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)carbamoyl]-6-(trifluoromethyl)phenyl]methanesulfinic acid.
| Compound Name | [2-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)carbamoyl]-6-(trifluoromethyl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 138703356 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [2-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)carbamoyl]-6-(trifluoromethyl)phenyl]methanesulfinic acid |
| SMILES | Cc1nnc(NC(=O)c2ccc(C(F)(F)F)c(CS(=O)O)c2C)o1 |
| InChI | InChI=1S/C13H12F3N3O4S/c1-6-8(11(20)17-12-19-18-7(2)23-12)3-4-10(13(14,15)16)9(6)5-24(21)22/h3-4H,5H2,1-2H3,(H,21,22)(H,17,19,20) |
| InChIKey | XVSIUMSTRLKHNL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|