C10H18N4O — CID 138705209
1-N-methyl-6-[2-(methylamino)ethoxy]benzene-1,2,4-triamine (PubChem CID 138705209) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-N-methyl-6-[2-(methylamino)ethoxy]benzene-1,2,4-triamine.
| Compound Name | 1-N-methyl-6-[2-(methylamino)ethoxy]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 138705209 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-N-methyl-6-[2-(methylamino)ethoxy]benzene-1,2,4-triamine |
| SMILES | CNCCOc1cc(N)cc(N)c1NC |
| InChI | InChI=1S/C10H18N4O/c1-13-3-4-15-9-6-7(11)5-8(12)10(9)14-2/h5-6,13-14H,3-4,11-12H2,1-2H3 |
| InChIKey | FPDXBAMLISVPIU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|