C32H58O8 — CID 138705747
(6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;octadecan-2-yl prop-2-enoate (PubChem CID 138705747) has the molecular formula C32H58O8 and a molecular weight of 570.81 g/mol. Its IUPAC name is (6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;octadecan-2-yl prop-2-enoate.
| Compound Name | (6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;octadecan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 138705747 |
| Molecular Formula | C32H58O8 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | (6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;octadecan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCCCCCCCCCCCCCCC.C=CC(=O)OC1COCC(OCC)OCCO1 |
| InChI | InChI=1S/C21H40O2.C11H18O6/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(3)23-21(22)5-2;1-3-9(12)17-11-8-13-7-10(14-4-2)15-5-6-16-11/h5,20H,2,4,6-19H2,1,3H3;3,10-11H,1,4-8H2,2H3 |
| InChIKey | BFTVVTQFIBLLSY-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|