C33H60O8 — CID 138705768
(6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;nonadecan-2-yl prop-2-enoate (PubChem CID 138705768) has the molecular formula C33H60O8 and a molecular weight of 584.84 g/mol. Its IUPAC name is (6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;nonadecan-2-yl prop-2-enoate.
| Compound Name | (6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;nonadecan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 138705768 |
| Molecular Formula | C33H60O8 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.43 |
| IUPAC Name | (6-ethoxy-1,4,7-trioxonan-2-yl) prop-2-enoate;nonadecan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCCCCCCCCCCCCCCCC.C=CC(=O)OC1COCC(OCC)OCCO1 |
| InChI | InChI=1S/C22H42O2.C11H18O6/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(3)24-22(23)5-2;1-3-9(12)17-11-8-13-7-10(14-4-2)15-5-6-16-11/h5,21H,2,4,6-20H2,1,3H3;3,10-11H,1,4-8H2,2H3 |
| InChIKey | BNJWXARYOSESCN-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|