C12H20O6 — CID 138705758
(6-ethoxy-1,4,7-trioxonan-2-yl) 2-methylprop-2-enoate (PubChem CID 138705758) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (6-ethoxy-1,4,7-trioxonan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (6-ethoxy-1,4,7-trioxonan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138705758 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (6-ethoxy-1,4,7-trioxonan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1COCC(OCC)OCCO1 |
| InChI | InChI=1S/C12H20O6/c1-4-15-10-7-14-8-11(17-6-5-16-10)18-12(13)9(2)3/h10-11H,2,4-8H2,1,3H3 |
| InChIKey | USUBFHNHVDYRTO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|