C31H34N2O8 — CID 138706109
9H-fluoren-9-ylmethoxycarbonyl 2-[1-[5-(3-methylpentan-2-yl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]oxyacetate (PubChem CID 138706109) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethoxycarbonyl 2-[1-[5-(3-methylpentan-2-yl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]oxyacetate.
| Compound Name | 9H-fluoren-9-ylmethoxycarbonyl 2-[1-[5-(3-methylpentan-2-yl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]oxyacetate |
|---|---|
| PubChem CID | 138706109 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 9H-fluoren-9-ylmethoxycarbonyl 2-[1-[5-(3-methylpentan-2-yl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]oxyacetate |
| SMILES | CCC(C)C(C)C1CCC(n2cc(OCC(=O)OC(=O)OCC3c4ccccc4-c4ccccc43)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C31H34N2O8/c1-4-18(2)19(3)25-13-14-27(40-25)33-15-26(29(35)32-30(33)36)38-17-28(34)41-31(37)39-16-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,15,18-19,24-25,27H,4,13-14,16-17H2,1-3H3,(H,32,35,36) |
| InChIKey | DJRLHJUJLISRMN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|