C15H22N2O6 — CID 174012917
2-[2,4-dioxo-1-[(2R)-5-pentan-2-yloxolan-2-yl]pyrimidin-5-yl]oxyacetic acid (PubChem CID 174012917) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[2,4-dioxo-1-[(2R)-5-pentan-2-yloxolan-2-yl]pyrimidin-5-yl]oxyacetic acid.
| Compound Name | 2-[2,4-dioxo-1-[(2R)-5-pentan-2-yloxolan-2-yl]pyrimidin-5-yl]oxyacetic acid |
|---|---|
| PubChem CID | 174012917 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[2,4-dioxo-1-[(2R)-5-pentan-2-yloxolan-2-yl]pyrimidin-5-yl]oxyacetic acid |
| SMILES | CCCC(C)C1CC[C@H](n2cc(OCC(=O)O)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C15H22N2O6/c1-3-4-9(2)10-5-6-12(23-10)17-7-11(22-8-13(18)19)14(20)16-15(17)21/h7,9-10,12H,3-6,8H2,1-2H3,(H,18,19)(H,16,20,21)/t9?,10?,12-/m1/s1 |
| InChIKey | IETJLIWRISJNSA-RTYFJBAXSA-N |
| XLogP | 1.11 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |