C10H12N4O2S — CID 138706581
aminothiourea;1-methylindole-2,3-dione (PubChem CID 138706581) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is aminothiourea;1-methylindole-2,3-dione.
| Compound Name | aminothiourea;1-methylindole-2,3-dione |
|---|---|
| PubChem CID | 138706581 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | aminothiourea;1-methylindole-2,3-dione |
| SMILES | CN1C(=O)C(=O)c2ccccc21.NNC(N)=S |
| InChI | InChI=1S/C9H7NO2.CH5N3S/c1-10-7-5-3-2-4-6(7)8(11)9(10)12;2-1(5)4-3/h2-5H,1H3;3H2,(H3,2,4,5) |
| InChIKey | KWZKMTAXKNJSOJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|