C31H32F2N4O2 — CID 138707387
2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-4-(2,3-difluorophenyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 138707387) has the molecular formula C31H32F2N4O2 and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-4-(2,3-difluorophenyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-4-(2,3-difluorophenyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 138707387 |
| Molecular Formula | C31H32F2N4O2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-4-(2,3-difluorophenyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2cc(-c3cccc(F)c3F)ccc2/C(N)=N/O)cc1 |
| InChI | InChI=1S/C31H32F2N4O2/c1-2-3-9-27-35-31(16-4-5-17-31)30(38)37(27)19-20-10-12-21(13-11-20)25-18-22(14-15-24(25)29(34)36-39)23-7-6-8-26(32)28(23)33/h6-8,10-15,18,39H,2-5,9,16-17,19H2,1H3,(H2,34,36) |
| InChIKey | ARNSZXPUOZVOMF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|