C27H33N5O — CID 142933033
2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 142933033) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one.
| Compound Name | 2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one |
|---|---|
| PubChem CID | 142933033 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | C=C(N/N=N/C)c1ccccc1-c1ccc(CN2C(=O)C3(CCCC3)N=C2CCCC)cc1 |
| InChI | InChI=1S/C27H33N5O/c1-4-5-12-25-29-27(17-8-9-18-27)26(33)32(25)19-21-13-15-22(16-14-21)24-11-7-6-10-23(24)20(2)30-31-28-3/h6-7,10-11,13-16H,2,4-5,8-9,12,17-19H2,1,3H3,(H,28,30) |
| InChIKey | MUCAJSUQNWQARO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 69.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|