C45H46N6O — CID 89030518
N'-amino-2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-N-(methylideneamino)-N-tritylbenzenecarboximidamide (PubChem CID 89030518) has the molecular formula C45H46N6O and a molecular weight of 686.90 g/mol. Its IUPAC name is N'-amino-2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-N-(methylideneamino)-N-tritylbenzenecarboximidamide.
| Compound Name | N'-amino-2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-N-(methylideneamino)-N-tritylbenzenecarboximidamide |
|---|---|
| PubChem CID | 89030518 |
| Molecular Formula | C45H46N6O |
| Molecular Weight | 686.90 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | N'-amino-2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-N-(methylideneamino)-N-tritylbenzenecarboximidamide |
| SMILES | C=NN(/C(=N\N)c1ccccc1-c1ccc(CN2C(=O)C3(CCCC3)N=C2CCCC)cc1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H46N6O/c1-3-4-26-41-48-44(31-16-17-32-44)43(52)50(41)33-34-27-29-35(30-28-34)39-24-14-15-25-40(39)42(49-46)51(47-2)45(36-18-8-5-9-19-36,37-20-10-6-11-21-37)38-22-12-7-13-23-38/h5-15,18-25,27-30H,2-4,16-17,26,31-33,46H2,1H3/b49-42- |
| InChIKey | QFOQMORSESXAON-XVSJYXLOSA-N |
| XLogP | 9.13 |
| TPSA | 86.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.90 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|